C30H32ClN7O4S2 — CID 24899068
4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperazine-1-carbothioamide;hydrochloride (PubChem CID 24899068) has the molecular formula C30H32ClN7O4S2 and a molecular weight of 654.22 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperazine-1-carbothioamide;hydrochloride.
| Compound Name | 4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperazine-1-carbothioamide;hydrochloride |
|---|---|
| PubChem CID | 24899068 |
| Molecular Formula | C30H32ClN7O4S2 |
| Molecular Weight | 654.22 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | 4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperazine-1-carbothioamide;hydrochloride |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5ccc(S(=O)(=O)Nc6ccc(C)cc6)cc5)CC4)c3c2cc1OC.Cl |
| InChI | InChI=1S/C30H31N7O4S2.ClH/c1-19-4-6-21(7-5-19)35-43(38,39)22-10-8-20(9-11-22)33-30(42)37-14-12-36(13-15-37)29-27-23-16-25(40-2)26(41-3)17-24(23)34-28(27)31-18-32-29;/h4-11,16-18,35H,12-15H2,1-3H3,(H,33,42)(H,31,32,34);1H |
| InChIKey | XWRRTYJDTWNJDP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.22 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|