C30H29N7O5S2 — CID 24899825
N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide (PubChem CID 24899825) has the molecular formula C30H29N7O5S2 and a molecular weight of 631.74 g/mol. Its IUPAC name is N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide.
| Compound Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 24899825 |
| Molecular Formula | C30H29N7O5S2 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.17 |
| IUPAC Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonylbenzamide |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5ccc(S(=O)(=O)NC(=O)c6ccccc6)cc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C30H29N7O5S2/c1-41-24-16-22-23(17-25(24)42-2)34-27-26(22)28(32-18-31-27)36-12-14-37(15-13-36)30(43)33-20-8-10-21(11-9-20)44(39,40)35-29(38)19-6-4-3-5-7-19/h3-11,16-18H,12-15H2,1-2H3,(H,33,43)(H,35,38)(H,31,32,34) |
| InChIKey | KACUUNUKAIWKKZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 141.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|