C30H29N7O3S — CID 160695771
N-[5-[2-[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazin-1-yl]-2-sulfanylideneethyl]-2-pyridinyl]benzamide (PubChem CID 160695771) has the molecular formula C30H29N7O3S and a molecular weight of 567.68 g/mol. Its IUPAC name is N-[5-[2-[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazin-1-yl]-2-sulfanylideneethyl]-2-pyridinyl]benzamide.
| Compound Name | N-[5-[2-[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazin-1-yl]-2-sulfanylideneethyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 160695771 |
| Molecular Formula | C30H29N7O3S |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | N-[5-[2-[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazin-1-yl]-2-sulfanylideneethyl]-2-pyridinyl]benzamide |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)Cc5ccc(NC(=O)c6ccccc6)nc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C30H29N7O3S/c1-39-23-15-21-22(16-24(23)40-2)34-28-27(21)29(33-18-32-28)37-12-10-36(11-13-37)26(41)14-19-8-9-25(31-17-19)35-30(38)20-6-4-3-5-7-20/h3-9,15-18H,10-14H2,1-2H3,(H,31,35,38)(H,32,33,34) |
| InChIKey | RPZBKLZLWCBAEA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|