C23H25N5O3S — CID 22707566
4-(6,7-dimethoxyquinazolin-4-yl)-N-phenacylpiperazine-1-carbothioamide (PubChem CID 22707566) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinazolin-4-yl)-N-phenacylpiperazine-1-carbothioamide.
| Compound Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-phenacylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 22707566 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-phenacylpiperazine-1-carbothioamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=S)NCC(=O)c4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C23H25N5O3S/c1-30-20-12-17-18(13-21(20)31-2)25-15-26-22(17)27-8-10-28(11-9-27)23(32)24-14-19(29)16-6-4-3-5-7-16/h3-7,12-13,15H,8-11,14H2,1-2H3,(H,24,32) |
| InChIKey | UDHZKFHIEKCGKP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|