C21H22BrN5O2S — CID 22707651
N-(3-bromophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide (PubChem CID 22707651) has the molecular formula C21H22BrN5O2S and a molecular weight of 488.41 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-(3-bromophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 22707651 |
| Molecular Formula | C21H22BrN5O2S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | N-(3-bromophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=S)Nc4cccc(Br)c4)CC3)c2cc1OC |
| InChI | InChI=1S/C21H22BrN5O2S/c1-28-18-11-16-17(12-19(18)29-2)23-13-24-20(16)26-6-8-27(9-7-26)21(30)25-15-5-3-4-14(22)10-15/h3-5,10-13H,6-9H2,1-2H3,(H,25,30) |
| InChIKey | GUMWHKSSCIHREU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|