C20H20F3N5O2S2 — CID 87455701
4-(6,7-dimethoxyquinazolin-4-yl)-N-[4-(trifluoromethyl)thiophen-2-yl]piperazine-1-carbothioamide (PubChem CID 87455701) has the molecular formula C20H20F3N5O2S2 and a molecular weight of 483.54 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinazolin-4-yl)-N-[4-(trifluoromethyl)thiophen-2-yl]piperazine-1-carbothioamide.
| Compound Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-[4-(trifluoromethyl)thiophen-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 87455701 |
| Molecular Formula | C20H20F3N5O2S2 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-[4-(trifluoromethyl)thiophen-2-yl]piperazine-1-carbothioamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=S)Nc4cc(C(F)(F)F)cs4)CC3)c2cc1OC |
| InChI | InChI=1S/C20H20F3N5O2S2/c1-29-15-8-13-14(9-16(15)30-2)24-11-25-18(13)27-3-5-28(6-4-27)19(31)26-17-7-12(10-32-17)20(21,22)23/h7-11H,3-6H2,1-2H3,(H,26,31) |
| InChIKey | VYLMLENTSXJRCN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|