C21H21BrClN5O2S — CID 11027750
N-(4-bromo-3-chlorophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide (PubChem CID 11027750) has the molecular formula C21H21BrClN5O2S and a molecular weight of 522.86 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11027750 |
| Molecular Formula | C21H21BrClN5O2S |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carbothioamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=S)Nc4ccc(Br)c(Cl)c4)CC3)c2cc1OC |
| InChI | InChI=1S/C21H21BrClN5O2S/c1-29-18-10-14-17(11-19(18)30-2)24-12-25-20(14)27-5-7-28(8-6-27)21(31)26-13-3-4-15(22)16(23)9-13/h3-4,9-12H,5-8H2,1-2H3,(H,26,31) |
| InChIKey | SEEORMPQTKDNNU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|