C22H24FN5O2S — CID 22707478
4-(6,7-dimethoxyquinazolin-4-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 22707478) has the molecular formula C22H24FN5O2S and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinazolin-4-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 22707478 |
| Molecular Formula | C22H24FN5O2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-(6,7-dimethoxyquinazolin-4-yl)-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | COc1cc2ncnc(N3CCN(C(=S)NCc4ccc(F)cc4)CC3)c2cc1OC |
| InChI | InChI=1S/C22H24FN5O2S/c1-29-19-11-17-18(12-20(19)30-2)25-14-26-21(17)27-7-9-28(10-8-27)22(31)24-13-15-3-5-16(23)6-4-15/h3-6,11-12,14H,7-10,13H2,1-2H3,(H,24,31) |
| InChIKey | KYCHBBWQSZLCMR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|