C22H25N5OS — CID 11350308
N-benzyl-4-(6-methoxy-7-methylquinazolin-4-yl)piperazine-1-carbothioamide (PubChem CID 11350308) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is N-benzyl-4-(6-methoxy-7-methylquinazolin-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-benzyl-4-(6-methoxy-7-methylquinazolin-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11350308 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-benzyl-4-(6-methoxy-7-methylquinazolin-4-yl)piperazine-1-carbothioamide |
| SMILES | COc1cc2c(N3CCN(C(=S)NCc4ccccc4)CC3)ncnc2cc1C |
| InChI | InChI=1S/C22H25N5OS/c1-16-12-19-18(13-20(16)28-2)21(25-15-24-19)26-8-10-27(11-9-26)22(29)23-14-17-6-4-3-5-7-17/h3-7,12-13,15H,8-11,14H2,1-2H3,(H,23,29) |
| InChIKey | YTYDANXWBYHKER-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|