C21H22N4O4 — CID 22707591
4-(6-methoxy-7-phenylmethoxyquinazolin-4-yl)piperazine-1-carboxylic acid (PubChem CID 22707591) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-(6-methoxy-7-phenylmethoxyquinazolin-4-yl)piperazine-1-carboxylic acid.
| Compound Name | 4-(6-methoxy-7-phenylmethoxyquinazolin-4-yl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 22707591 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-(6-methoxy-7-phenylmethoxyquinazolin-4-yl)piperazine-1-carboxylic acid |
| SMILES | COc1cc2c(N3CCN(C(=O)O)CC3)ncnc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H22N4O4/c1-28-18-11-16-17(12-19(18)29-13-15-5-3-2-4-6-15)22-14-23-20(16)24-7-9-25(10-8-24)21(26)27/h2-6,11-12,14H,7-10,13H2,1H3,(H,26,27) |
| InChIKey | XTRLPEGKXITQBZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |