C20H28N4O4 — CID 11429163
tert-butyl 4-(6-ethoxy-7-methoxyquinazolin-4-yl)piperazine-1-carboxylate (PubChem CID 11429163) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is tert-butyl 4-(6-ethoxy-7-methoxyquinazolin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-ethoxy-7-methoxyquinazolin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11429163 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | tert-butyl 4-(6-ethoxy-7-methoxyquinazolin-4-yl)piperazine-1-carboxylate |
| SMILES | CCOc1cc2c(N3CCN(C(=O)OC(C)(C)C)CC3)ncnc2cc1OC |
| InChI | InChI=1S/C20H28N4O4/c1-6-27-17-11-14-15(12-16(17)26-5)21-13-22-18(14)23-7-9-24(10-8-23)19(25)28-20(2,3)4/h11-13H,6-10H2,1-5H3 |
| InChIKey | MHGRDXVINWKDPW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |