C16H20FN5O2 — CID 11393449
tert-butyl 4-(6-fluoropyrido[3,4-d]pyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 11393449) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is tert-butyl 4-(6-fluoropyrido[3,4-d]pyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-fluoropyrido[3,4-d]pyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11393449 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl 4-(6-fluoropyrido[3,4-d]pyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncnc3cnc(F)cc23)CC1 |
| InChI | InChI=1S/C16H20FN5O2/c1-16(2,3)24-15(23)22-6-4-21(5-7-22)14-11-8-13(17)18-9-12(11)19-10-20-14/h8-10H,4-7H2,1-3H3 |
| InChIKey | LTUNTWJCXHFGDT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|