C14H21IN4O2 — CID 156898021
tert-butyl 4-(5-iodo-6-methylpyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 156898021) has the molecular formula C14H21IN4O2 and a molecular weight of 404.25 g/mol. Its IUPAC name is tert-butyl 4-(5-iodo-6-methylpyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-iodo-6-methylpyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156898021 |
| Molecular Formula | C14H21IN4O2 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | tert-butyl 4-(5-iodo-6-methylpyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | Cc1ncnc(N2CCN(C(=O)OC(C)(C)C)CC2)c1I |
| InChI | InChI=1S/C14H21IN4O2/c1-10-11(15)12(17-9-16-10)18-5-7-19(8-6-18)13(20)21-14(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | OQSUHXZJEBKLNU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|