C13H20ClN5O2 — CID 71748362
tert-butyl 4-(5-amino-6-chloropyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 71748362) has the molecular formula C13H20ClN5O2 and a molecular weight of 313.79 g/mol. Its IUPAC name is tert-butyl 4-(5-amino-6-chloropyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-amino-6-chloropyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71748362 |
| Molecular Formula | C13H20ClN5O2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | tert-butyl 4-(5-amino-6-chloropyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncnc(Cl)c2N)CC1 |
| InChI | InChI=1S/C13H20ClN5O2/c1-13(2,3)21-12(20)19-6-4-18(5-7-19)11-9(15)10(14)16-8-17-11/h8H,4-7,15H2,1-3H3 |
| InChIKey | TZKQCWFMOBLFIR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |