C19H22ClN5O2 — CID 170007411
tert-butyl 4-(4-chloro-9H-pyrimido[4,5-b]indol-6-yl)piperazine-1-carboxylate (PubChem CID 170007411) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is tert-butyl 4-(4-chloro-9H-pyrimido[4,5-b]indol-6-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chloro-9H-pyrimido[4,5-b]indol-6-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170007411 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | tert-butyl 4-(4-chloro-9H-pyrimido[4,5-b]indol-6-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3[nH]c4ncnc(Cl)c4c3c2)CC1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-19(2,3)27-18(26)25-8-6-24(7-9-25)12-4-5-14-13(10-12)15-16(20)21-11-22-17(15)23-14/h4-5,10-11H,6-9H2,1-3H3,(H,21,22,23) |
| InChIKey | YRLJAAKIYYTQFE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |