C30H50N4O6S — CID 102191974
tritert-butyl 10-(4-methylsulfanylphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 102191974) has the molecular formula C30H50N4O6S and a molecular weight of 594.82 g/mol. Its IUPAC name is tritert-butyl 10-(4-methylsulfanylphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-(4-methylsulfanylphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 102191974 |
| Molecular Formula | C30H50N4O6S |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | tritert-butyl 10-(4-methylsulfanylphenyl)-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CSc1ccc(N2CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C30H50N4O6S/c1-28(2,3)38-25(35)32-17-15-31(23-11-13-24(41-10)14-12-23)16-18-33(26(36)39-29(4,5)6)20-22-34(21-19-32)27(37)40-30(7,8)9/h11-14H,15-22H2,1-10H3 |
| InChIKey | XCVPISZUAOBZCR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 91.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|