C17H27BrN2O2 — CID 156798550
tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;ethane (PubChem CID 156798550) has the molecular formula C17H27BrN2O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 156798550 |
| Molecular Formula | C17H27BrN2O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H21BrN2O2.C2H6/c1-15(2,3)20-14(19)18-10-8-17(9-11-18)13-6-4-12(16)5-7-13;1-2/h4-7H,8-11H2,1-3H3;1-2H3 |
| InChIKey | PUQSKWHXUTVMHX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |