C17H27N3O4S — CID 69249355
tert-butyl 4-(4-methylsulfanylphenyl)piperazine-1-carboxylate;carbamic acid (PubChem CID 69249355) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is tert-butyl 4-(4-methylsulfanylphenyl)piperazine-1-carboxylate;carbamic acid.
| Compound Name | tert-butyl 4-(4-methylsulfanylphenyl)piperazine-1-carboxylate;carbamic acid |
|---|---|
| PubChem CID | 69249355 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | tert-butyl 4-(4-methylsulfanylphenyl)piperazine-1-carboxylate;carbamic acid |
| SMILES | CSc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1.NC(=O)O |
| InChI | InChI=1S/C16H24N2O2S.CH3NO2/c1-16(2,3)20-15(19)18-11-9-17(10-12-18)13-5-7-14(21-4)8-6-13;2-1(3)4/h5-8H,9-12H2,1-4H3;2H2,(H,3,4) |
| InChIKey | DJFWFZAQDHYDSG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |