C16H21ClN2O3 — CID 57439881
tert-butyl 4-(4-carbonochloridoylphenyl)piperazine-1-carboxylate (PubChem CID 57439881) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is tert-butyl 4-(4-carbonochloridoylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-carbonochloridoylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57439881 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | tert-butyl 4-(4-carbonochloridoylphenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)Cl)cc2)CC1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-16(2,3)22-15(21)19-10-8-18(9-11-19)13-6-4-12(5-7-13)14(17)20/h4-7H,8-11H2,1-3H3 |
| InChIKey | FVJBEQTXVFGXFB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|