C25H39BrN2O7 — CID 158968618
tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (PubChem CID 158968618) has the molecular formula C25H39BrN2O7 and a molecular weight of 559.50 g/mol. Its IUPAC name is tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate.
| Compound Name | tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
|---|---|
| PubChem CID | 158968618 |
| Molecular Formula | C25H39BrN2O7 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(Br)cc2)CC1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21BrN2O2.C10H18O5/c1-15(2,3)20-14(19)18-10-8-17(9-11-18)13-6-4-12(16)5-7-13;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6/h4-7H,8-11H2,1-3H3;1-6H3 |
| InChIKey | JNNGZNMMNVXXPC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|