C23H35BrN2O3 — CID 162741845
tert-butyl 4-[[1-(4-bromophenyl)piperidin-4-yl]methoxymethyl]piperidine-1-carboxylate (PubChem CID 162741845) has the molecular formula C23H35BrN2O3 and a molecular weight of 467.45 g/mol. Its IUPAC name is tert-butyl 4-[[1-(4-bromophenyl)piperidin-4-yl]methoxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(4-bromophenyl)piperidin-4-yl]methoxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162741845 |
| Molecular Formula | C23H35BrN2O3 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | tert-butyl 4-[[1-(4-bromophenyl)piperidin-4-yl]methoxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COCC2CCN(c3ccc(Br)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H35BrN2O3/c1-23(2,3)29-22(27)26-14-10-19(11-15-26)17-28-16-18-8-12-25(13-9-18)21-6-4-20(24)5-7-21/h4-7,18-19H,8-17H2,1-3H3 |
| InChIKey | PIMIFFMXLMCITM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |