C17H24BrNO3S — CID 155231666
tert-butyl 4-[(4-bromophenyl)sulfinylmethyl]piperidine-1-carboxylate (PubChem CID 155231666) has the molecular formula C17H24BrNO3S and a molecular weight of 402.35 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromophenyl)sulfinylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromophenyl)sulfinylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155231666 |
| Molecular Formula | C17H24BrNO3S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | tert-butyl 4-[(4-bromophenyl)sulfinylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CS(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C17H24BrNO3S/c1-17(2,3)22-16(20)19-10-8-13(9-11-19)12-23(21)15-6-4-14(18)5-7-15/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | XUMXMMBYCXGTSI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |