C11H21NO2S — CID 58694772
tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate (PubChem CID 58694772) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58694772 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CS)CC1 |
| InChI | InChI=1S/C11H21NO2S/c1-11(2,3)14-10(13)12-6-4-9(8-15)5-7-12/h9,15H,4-8H2,1-3H3 |
| InChIKey | VEPAXJUGIFPJNK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|