C24H44N2O5S2 — CID 161023381
tert-butyl 4-(acetylsulfanylmethyl)piperidine-1-carboxylate;tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate (PubChem CID 161023381) has the molecular formula C24H44N2O5S2 and a molecular weight of 504.76 g/mol. Its IUPAC name is tert-butyl 4-(acetylsulfanylmethyl)piperidine-1-carboxylate;tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(acetylsulfanylmethyl)piperidine-1-carboxylate;tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161023381 |
| Molecular Formula | C24H44N2O5S2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | tert-butyl 4-(acetylsulfanylmethyl)piperidine-1-carboxylate;tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate |
| SMILES | CC(=O)SCC1CCN(C(=O)OC(C)(C)C)CC1.CC(C)(C)OC(=O)N1CCC(CS)CC1 |
| InChI | InChI=1S/C13H23NO3S.C11H21NO2S/c1-10(15)18-9-11-5-7-14(8-6-11)12(16)17-13(2,3)4;1-11(2,3)14-10(13)12-6-4-9(8-15)5-7-12/h11H,5-9H2,1-4H3;9,15H,4-8H2,1-3H3 |
| InChIKey | TYQZXMWJURJSGF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 76.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|