C15H23N3O3S — CID 97171549
tert-butyl 4-[[(S)-pyrimidin-2-ylsulfinyl]methyl]piperidine-1-carboxylate (PubChem CID 97171549) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl 4-[[(S)-pyrimidin-2-ylsulfinyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(S)-pyrimidin-2-ylsulfinyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97171549 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl 4-[[(S)-pyrimidin-2-ylsulfinyl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C[S@](=O)c2ncccn2)CC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2,3)21-14(19)18-9-5-12(6-10-18)11-22(20)13-16-7-4-8-17-13/h4,7-8,12H,5-6,9-11H2,1-3H3/t22-/m0/s1 |
| InChIKey | LUDNZHBVWDMNMP-QFIPXVFZSA-N |
| XLogP | 2.23 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |