C14H21N3O3S — CID 71629995
tert-butyl 4-pyrimidin-2-ylsulfinylpiperidine-1-carboxylate (PubChem CID 71629995) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is tert-butyl 4-pyrimidin-2-ylsulfinylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-pyrimidin-2-ylsulfinylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71629995 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl 4-pyrimidin-2-ylsulfinylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)c2ncccn2)CC1 |
| InChI | InChI=1S/C14H21N3O3S/c1-14(2,3)20-13(18)17-9-5-11(6-10-17)21(19)12-15-7-4-8-16-12/h4,7-8,11H,5-6,9-10H2,1-3H3 |
| InChIKey | VNTAFRBLMRIBNR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |