C14H20N2O3S — CID 97170970
tert-butyl (3S)-3-[(R)-pyridin-4-ylsulfinyl]pyrrolidine-1-carboxylate (PubChem CID 97170970) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(R)-pyridin-4-ylsulfinyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(R)-pyridin-4-ylsulfinyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97170970 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | tert-butyl (3S)-3-[(R)-pyridin-4-ylsulfinyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([S@@](=O)c2ccncc2)C1 |
| InChI | InChI=1S/C14H20N2O3S/c1-14(2,3)19-13(17)16-9-6-12(10-16)20(18)11-4-7-15-8-5-11/h4-5,7-8,12H,6,9-10H2,1-3H3/t12-,20-/m0/s1 |
| InChIKey | WUPBXAGICJKODN-YUNKPMOVSA-N |
| XLogP | 2.20 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |