C13H18ClN3O3S — CID 71629397
tert-butyl (3S)-3-(2-chloropyrimidin-4-yl)sulfinylpyrrolidine-1-carboxylate (PubChem CID 71629397) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2-chloropyrimidin-4-yl)sulfinylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(2-chloropyrimidin-4-yl)sulfinylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71629397 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | tert-butyl (3S)-3-(2-chloropyrimidin-4-yl)sulfinylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](S(=O)c2ccnc(Cl)n2)C1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-13(2,3)20-12(18)17-7-5-9(8-17)21(19)10-4-6-15-11(14)16-10/h4,6,9H,5,7-8H2,1-3H3/t9-,21?/m0/s1 |
| InChIKey | OMQCUKFGTLTQPM-BZEUWDEWSA-N |
| XLogP | 2.25 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |