C14H21ClN4O2 — CID 71646667
tert-butyl (3R)-3-[(2-chloropyrimidin-4-yl)-methylamino]pyrrolidine-1-carboxylate (PubChem CID 71646667) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(2-chloropyrimidin-4-yl)-methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(2-chloropyrimidin-4-yl)-methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71646667 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | tert-butyl (3R)-3-[(2-chloropyrimidin-4-yl)-methylamino]pyrrolidine-1-carboxylate |
| SMILES | CN(c1ccnc(Cl)n1)[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H21ClN4O2/c1-14(2,3)21-13(20)19-8-6-10(9-19)18(4)11-5-7-16-12(15)17-11/h5,7,10H,6,8-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | KCORFBVKPRLOFF-SNVBAGLBSA-N |
| XLogP | 2.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |