C16H21Cl2NO3S — CID 96845532
tert-butyl 4-[(S)-(2,4-dichlorophenyl)sulfinyl]piperidine-1-carboxylate (PubChem CID 96845532) has the molecular formula C16H21Cl2NO3S and a molecular weight of 378.32 g/mol. Its IUPAC name is tert-butyl 4-[(S)-(2,4-dichlorophenyl)sulfinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(S)-(2,4-dichlorophenyl)sulfinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 96845532 |
| Molecular Formula | C16H21Cl2NO3S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | tert-butyl 4-[(S)-(2,4-dichlorophenyl)sulfinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([S@](=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl2NO3S/c1-16(2,3)22-15(20)19-8-6-12(7-9-19)23(21)14-5-4-11(17)10-13(14)18/h4-5,10,12H,6-9H2,1-3H3/t23-/m0/s1 |
| InChIKey | HDYOGDFWKFVXDU-QHCPKHFHSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |