C18H23Cl2N3O4 — CID 9375528
tert-butyl 4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 9375528) has the molecular formula C18H23Cl2N3O4 and a molecular weight of 416.31 g/mol. Its IUPAC name is tert-butyl 4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 9375528 |
| Molecular Formula | C18H23Cl2N3O4 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | tert-butyl 4-[[(2,5-dichlorobenzoyl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H23Cl2N3O4/c1-18(2,3)27-17(26)23-8-6-11(7-9-23)15(24)21-22-16(25)13-10-12(19)4-5-14(13)20/h4-5,10-11H,6-9H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | MPAAIWJEXXZUDQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|