C16H23N3O5 — CID 49042732
tert-butyl 4-[(furan-3-carbonylamino)carbamoyl]piperidine-1-carboxylate (PubChem CID 49042732) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl 4-[(furan-3-carbonylamino)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(furan-3-carbonylamino)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 49042732 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl 4-[(furan-3-carbonylamino)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(22)19-7-4-11(5-8-19)13(20)17-18-14(21)12-6-9-23-10-12/h6,9-11H,4-5,7-8H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | QPDWFVRMBJXJNK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|