C21H26N4O4 — CID 55407431
tert-butyl 4-[(quinoline-2-carbonylamino)carbamoyl]piperidine-1-carboxylate (PubChem CID 55407431) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is tert-butyl 4-[(quinoline-2-carbonylamino)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(quinoline-2-carbonylamino)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55407431 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | tert-butyl 4-[(quinoline-2-carbonylamino)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)c2ccc3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H26N4O4/c1-21(2,3)29-20(28)25-12-10-15(11-13-25)18(26)23-24-19(27)17-9-8-14-6-4-5-7-16(14)22-17/h4-9,15H,10-13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | TZEZJJHDTIUJIQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|