C27H31N5O4 — CID 46651526
tert-butyl 4-[[(1,3-diphenylpyrazole-4-carbonyl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 46651526) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is tert-butyl 4-[[(1,3-diphenylpyrazole-4-carbonyl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(1,3-diphenylpyrazole-4-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46651526 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | tert-butyl 4-[[(1,3-diphenylpyrazole-4-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N5O4/c1-27(2,3)36-26(35)31-16-14-20(15-17-31)24(33)28-29-25(34)22-18-32(21-12-8-5-9-13-21)30-23(22)19-10-6-4-7-11-19/h4-13,18,20H,14-17H2,1-3H3,(H,28,33)(H,29,34) |
| InChIKey | IQJGJKRQLFGRBO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|