C23H25N5O4S — CID 24629750
N'-(1,3-diphenylpyrazole-4-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide (PubChem CID 24629750) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is N'-(1,3-diphenylpyrazole-4-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(1,3-diphenylpyrazole-4-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 24629750 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N'-(1,3-diphenylpyrazole-4-carbonyl)-1-methylsulfonylpiperidine-4-carbohydrazide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)NNC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N5O4S/c1-33(31,32)27-14-12-18(13-15-27)22(29)24-25-23(30)20-16-28(19-10-6-3-7-11-19)26-21(20)17-8-4-2-5-9-17/h2-11,16,18H,12-15H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | WFUSJQIYWWUABP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|