C26H22N4O3 — CID 24512674
N'-(3,4-dihydro-2H-chromene-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide (PubChem CID 24512674) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-chromene-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide.
| Compound Name | N'-(3,4-dihydro-2H-chromene-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24512674 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N'-(3,4-dihydro-2H-chromene-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1COc2ccccc2C1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H22N4O3/c31-25(20-15-19-11-7-8-14-23(19)33-17-20)27-28-26(32)22-16-30(21-12-5-2-6-13-21)29-24(22)18-9-3-1-4-10-18/h1-14,16,20H,15,17H2,(H,27,31)(H,28,32) |
| InChIKey | YAZGJEOMQDJNTM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|