C23H19N5O2S — CID 24512663
N'-(1,3-diphenylpyrazole-4-carbonyl)-2-methylsulfanylpyridine-3-carbohydrazide (PubChem CID 24512663) has the molecular formula C23H19N5O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is N'-(1,3-diphenylpyrazole-4-carbonyl)-2-methylsulfanylpyridine-3-carbohydrazide.
| Compound Name | N'-(1,3-diphenylpyrazole-4-carbonyl)-2-methylsulfanylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24512663 |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N'-(1,3-diphenylpyrazole-4-carbonyl)-2-methylsulfanylpyridine-3-carbohydrazide |
| SMILES | CSc1ncccc1C(=O)NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H19N5O2S/c1-31-23-18(13-8-14-24-23)21(29)25-26-22(30)19-15-28(17-11-6-3-7-12-17)27-20(19)16-9-4-2-5-10-16/h2-15H,1H3,(H,25,29)(H,26,30) |
| InChIKey | FTKWDUGAYZLLSJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|