C19H20N4O3S — CID 2431760
1,3-diphenyl-N'-propylsulfonylpyrazole-4-carbohydrazide (PubChem CID 2431760) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1,3-diphenyl-N'-propylsulfonylpyrazole-4-carbohydrazide.
| Compound Name | 1,3-diphenyl-N'-propylsulfonylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 2431760 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1,3-diphenyl-N'-propylsulfonylpyrazole-4-carbohydrazide |
| SMILES | CCCS(=O)(=O)NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4O3S/c1-2-13-27(25,26)22-20-19(24)17-14-23(16-11-7-4-8-12-16)21-18(17)15-9-5-3-6-10-15/h3-12,14,22H,2,13H2,1H3,(H,20,24) |
| InChIKey | CHUAAEZUEMIOFC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|