C20H21N3O2 — CID 111429323
N-(3-hydroxybutyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 111429323) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(3-hydroxybutyl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 111429323 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(3-hydroxybutyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | CC(O)CCNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H21N3O2/c1-15(24)12-13-21-20(25)18-14-23(17-10-6-3-7-11-17)22-19(18)16-8-4-2-5-9-16/h2-11,14-15,24H,12-13H2,1H3,(H,21,25) |
| InChIKey | AZUSPMCYNWOYCE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |