C24H20ClN3O — CID 18205042
N-[2-(4-chlorophenyl)ethyl]-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 18205042) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18205042 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3O/c25-20-13-11-18(12-14-20)15-16-26-24(29)22-17-28(21-9-5-2-6-10-21)27-23(22)19-7-3-1-4-8-19/h1-14,17H,15-16H2,(H,26,29) |
| InChIKey | VOAMWWJODQXQIW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |