C24H26N6OS — CID 56578122
3-(4-ethylphenyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 56578122) has the molecular formula C24H26N6OS and a molecular weight of 446.58 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(4-ethylphenyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56578122 |
| Molecular Formula | C24H26N6OS |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-(4-ethylphenyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | CCc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NCCc2n[nH]c(=S)n2CC)cc1 |
| InChI | InChI=1S/C24H26N6OS/c1-3-17-10-12-18(13-11-17)22-20(16-30(28-22)19-8-6-5-7-9-19)23(31)25-15-14-21-26-27-24(32)29(21)4-2/h5-13,16H,3-4,14-15H2,1-2H3,(H,25,31)(H,27,32) |
| InChIKey | QIBLEJGMIQDFRE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|