C22H22N6O2S — CID 56543719
N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 56543719) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56543719 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(3-methoxyphenyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | CCn1c(CNC(=O)c2cn(-c3ccccc3)nc2-c2cccc(OC)c2)n[nH]c1=S |
| InChI | InChI=1S/C22H22N6O2S/c1-3-27-19(24-25-22(27)31)13-23-21(29)18-14-28(16-9-5-4-6-10-16)26-20(18)15-8-7-11-17(12-15)30-2/h4-12,14H,3,13H2,1-2H3,(H,23,29)(H,25,31) |
| InChIKey | MEYCUNKITLVFIJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|