C23H16ClN5O4 — CID 35001195
N'-(2-chloro-4-nitrobenzoyl)-1,3-diphenylpyrazole-4-carbohydrazide (PubChem CID 35001195) has the molecular formula C23H16ClN5O4 and a molecular weight of 461.87 g/mol. Its IUPAC name is N'-(2-chloro-4-nitrobenzoyl)-1,3-diphenylpyrazole-4-carbohydrazide.
| Compound Name | N'-(2-chloro-4-nitrobenzoyl)-1,3-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 35001195 |
| Molecular Formula | C23H16ClN5O4 |
| Molecular Weight | 461.87 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | N'-(2-chloro-4-nitrobenzoyl)-1,3-diphenylpyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H16ClN5O4/c24-20-13-17(29(32)33)11-12-18(20)22(30)25-26-23(31)19-14-28(16-9-5-2-6-10-16)27-21(19)15-7-3-1-4-8-15/h1-14H,(H,25,30)(H,26,31) |
| InChIKey | HQTRRIXEYDWMQS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.87 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|