C22H19N7O4 — CID 60573626
N'-[3-(4-nitropyrazol-1-yl)propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide (PubChem CID 60573626) has the molecular formula C22H19N7O4 and a molecular weight of 445.44 g/mol. Its IUPAC name is N'-[3-(4-nitropyrazol-1-yl)propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide.
| Compound Name | N'-[3-(4-nitropyrazol-1-yl)propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 60573626 |
| Molecular Formula | C22H19N7O4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N'-[3-(4-nitropyrazol-1-yl)propanoyl]-1,3-diphenylpyrazole-4-carbohydrazide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H19N7O4/c30-20(11-12-27-14-18(13-23-27)29(32)33)24-25-22(31)19-15-28(17-9-5-2-6-10-17)26-21(19)16-7-3-1-4-8-16/h1-10,13-15H,11-12H2,(H,24,30)(H,25,31) |
| InChIKey | FVTGMJDVJONGRK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|