C25H19N5O4 — CID 26664796
N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-1,3-diphenylpyrazole-4-carbohydrazide (PubChem CID 26664796) has the molecular formula C25H19N5O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-1,3-diphenylpyrazole-4-carbohydrazide.
| Compound Name | N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-1,3-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26664796 |
| Molecular Formula | C25H19N5O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-1,3-diphenylpyrazole-4-carbohydrazide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H19N5O4/c31-23(15-14-18-8-7-13-21(16-18)30(33)34)26-27-25(32)22-17-29(20-11-5-2-6-12-20)28-24(22)19-9-3-1-4-10-19/h1-17H,(H,26,31)(H,27,32)/b15-14+ |
| InChIKey | BPMPIFHLAVKXCA-CCEZHUSRSA-N |
| XLogP | 3.92 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|