C20H16N4O4 — CID 9314025
N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2-pyrrol-1-ylbenzohydrazide (PubChem CID 9314025) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2-pyrrol-1-ylbenzohydrazide.
| Compound Name | N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2-pyrrol-1-ylbenzohydrazide |
|---|---|
| PubChem CID | 9314025 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2-pyrrol-1-ylbenzohydrazide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NNC(=O)c1ccccc1-n1cccc1 |
| InChI | InChI=1S/C20H16N4O4/c25-19(11-10-15-6-5-7-16(14-15)24(27)28)21-22-20(26)17-8-1-2-9-18(17)23-12-3-4-13-23/h1-14H,(H,21,25)(H,22,26)/b11-10+ |
| InChIKey | QTZUPFCQBSGTPQ-ZHACJKMWSA-N |
| XLogP | 2.86 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|