C18H18N4O4 — CID 30485890
3-(dimethylamino)-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide (PubChem CID 30485890) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 3-(dimethylamino)-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 3-(dimethylamino)-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 30485890 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 3-(dimethylamino)-N'-[(E)-3-(3-nitrophenyl)prop-2-enoyl]benzohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)/C=C/c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H18N4O4/c1-21(2)15-7-4-6-14(12-15)18(24)20-19-17(23)10-9-13-5-3-8-16(11-13)22(25)26/h3-12H,1-2H3,(H,19,23)(H,20,24)/b10-9+ |
| InChIKey | GXUZNTRGKYCCNU-MDZDMXLPSA-N |
| XLogP | 2.14 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|