C20H21N3O3 — CID 35824588
N'-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide (PubChem CID 35824588) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N'-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide.
| Compound Name | N'-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide |
|---|---|
| PubChem CID | 35824588 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N'-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoyl]-3-(dimethylamino)benzohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)/C=C/c2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-23(2)17-5-3-4-16(13-17)20(25)22-21-19(24)9-7-14-6-8-18-15(12-14)10-11-26-18/h3-9,12-13H,10-11H2,1-2H3,(H,21,24)(H,22,25)/b9-7+ |
| InChIKey | KTYPHSOFAHMUCZ-VQHVLOKHSA-N |
| XLogP | 2.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|