C18H16N2O4 — CID 9414776
N'-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]benzohydrazide (PubChem CID 9414776) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is N'-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | N'-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9414776 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N'-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCCO2)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O4/c21-17(19-20-18(22)14-4-2-1-3-5-14)9-7-13-6-8-15-16(12-13)24-11-10-23-15/h1-9,12H,10-11H2,(H,19,21)(H,20,22)/b9-7+ |
| InChIKey | AWBCVMPQHOQIFQ-VQHVLOKHSA-N |
| XLogP | 1.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|