C20H20N2O7 — CID 2469632
N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide (PubChem CID 2469632) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 2469632 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)/C=C/c2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O7/c1-25-16-9-13(10-17(26-2)19(16)27-3)20(24)22-21-18(23)7-5-12-4-6-14-15(8-12)29-11-28-14/h4-10H,11H2,1-3H3,(H,21,23)(H,22,24)/b7-5+ |
| InChIKey | CKLPDRHIVZROAP-FNORWQNLSA-N |
| XLogP | 1.92 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|